Etiket arşivi: python z score for two population

Python İki Popülasyon İçin Z Skoru Hesaplama Kodu

İki popülasyon için Python ile aşağıdaki kod vasıtasıyla iki kuyruklu Z Skoru hesaplayabilirsiniz. Girdi olarak n1, n2, p1 ve p2 değerlerini girmeniz gerekmektedir. Çıktı olarak Z Skoru değeri verilecektir.

[pastacode lang=”python” manual=”%23!%2Fusr%2Fbin%2Fenv%20python%0A%23-*-%20coding%3A%20utf-8%20-*-%0Afrom%20__future__%20import%20division%0Aimport%20math%0A%0Ap1%20%3D%200.34%0Ap2%20%3D%200.67%0An1%20%3D%20300%0An2%20%3D%20200%0A%0Adef%20calculate_z_score(p1%2C%20p2%2C%20n1%2C%20n2)%3A%0A%09proportion_of_two_samples%20%3D%20(p1%20%2B%20p2)%2F2%0A%09z_score%20%3D%20(p1-p2)%20%2F%20math.sqrt((proportion_of_two_samples%20*%20(1-proportion_of_two_samples))%20*%20(1%2Fn1%20%2B%201%2Fn2))%0A%09return%20z_score%0A%0Aprint%20calculate_z_score(p1%2C%20p2%2C%20n1%2C%20n2)” message=”” highlight=”” provider=”manual”/]

Bugün 1, bugüne kadar toplam 214 kez ziyaret edildi.